C15H12N4OS — CID 137088957
4-[[3-(5-amino-1,3,4-thiadiazol-2-yl)phenyl]iminomethyl]phenol (PubChem CID 137088957) has the molecular formula C15H12N4OS and a molecular weight of 296.36 g/mol. Its IUPAC name is 4-[[3-(5-amino-1,3,4-thiadiazol-2-yl)phenyl]iminomethyl]phenol.
| Compound Name | 4-[[3-(5-amino-1,3,4-thiadiazol-2-yl)phenyl]iminomethyl]phenol |
|---|---|
| PubChem CID | 137088957 |
| Molecular Formula | C15H12N4OS |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | 4-[[3-(5-amino-1,3,4-thiadiazol-2-yl)phenyl]iminomethyl]phenol |
| SMILES | Nc1nnc(-c2cccc(/N=C/c3ccc(O)cc3)c2)s1 |
| InChI | InChI=1S/C15H12N4OS/c16-15-19-18-14(21-15)11-2-1-3-12(8-11)17-9-10-4-6-13(20)7-5-10/h1-9,20H,(H2,16,19)/b17-9+ |
| InChIKey | WJSHZCLVWXKIQE-RQZCQDPDSA-N |
| XLogP | 3.24 |
| TPSA | 84.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|