C9H9N5S2 — CID 87683269
[3-(5-amino-1,3,4-thiadiazol-2-yl)phenyl]thiourea (PubChem CID 87683269) has the molecular formula C9H9N5S2 and a molecular weight of 251.34 g/mol. Its IUPAC name is [3-(5-amino-1,3,4-thiadiazol-2-yl)phenyl]thiourea.
| Compound Name | [3-(5-amino-1,3,4-thiadiazol-2-yl)phenyl]thiourea |
|---|---|
| PubChem CID | 87683269 |
| Molecular Formula | C9H9N5S2 |
| Molecular Weight | 251.34 g/mol |
| Exact Mass | 251.03 |
| IUPAC Name | [3-(5-amino-1,3,4-thiadiazol-2-yl)phenyl]thiourea |
| SMILES | NC(=S)Nc1cccc(-c2nnc(N)s2)c1 |
| InChI | InChI=1S/C9H9N5S2/c10-8(15)12-6-3-1-2-5(4-6)7-13-14-9(11)16-7/h1-4H,(H2,11,14)(H3,10,12,15) |
| InChIKey | KGLSCEIJKDEMOL-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.34 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|