C9H7BrN4OS — CID 80616226
5-amino-N-(3-bromophenyl)-1,3,4-thiadiazole-2-carboxamide (PubChem CID 80616226) has the molecular formula C9H7BrN4OS and a molecular weight of 299.15 g/mol. Its IUPAC name is 5-amino-N-(3-bromophenyl)-1,3,4-thiadiazole-2-carboxamide.
| Compound Name | 5-amino-N-(3-bromophenyl)-1,3,4-thiadiazole-2-carboxamide |
|---|---|
| PubChem CID | 80616226 |
| Molecular Formula | C9H7BrN4OS |
| Molecular Weight | 299.15 g/mol |
| Exact Mass | 297.95 |
| IUPAC Name | 5-amino-N-(3-bromophenyl)-1,3,4-thiadiazole-2-carboxamide |
| SMILES | Nc1nnc(C(=O)Nc2cccc(Br)c2)s1 |
| InChI | InChI=1S/C9H7BrN4OS/c10-5-2-1-3-6(4-5)12-7(15)8-13-14-9(11)16-8/h1-4H,(H2,11,14)(H,12,15) |
| InChIKey | LJIHPWSXZFIHRT-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.15 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |