C16H17N7S — CID 155549560
2-[(E)-1-[2-(4-imidazol-1-ylphenyl)-4-methyl-1,3-thiazol-5-yl]ethylideneamino]guanidine (PubChem CID 155549560) has the molecular formula C16H17N7S and a molecular weight of 339.43 g/mol. Its IUPAC name is 2-[(E)-1-[2-(4-imidazol-1-ylphenyl)-4-methyl-1,3-thiazol-5-yl]ethylideneamino]guanidine.
| Compound Name | 2-[(E)-1-[2-(4-imidazol-1-ylphenyl)-4-methyl-1,3-thiazol-5-yl]ethylideneamino]guanidine |
|---|---|
| PubChem CID | 155549560 |
| Molecular Formula | C16H17N7S |
| Molecular Weight | 339.43 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 2-[(E)-1-[2-(4-imidazol-1-ylphenyl)-4-methyl-1,3-thiazol-5-yl]ethylideneamino]guanidine |
| SMILES | C/C(=N\N=C(N)N)c1sc(-c2ccc(-n3ccnc3)cc2)nc1C |
| InChI | InChI=1S/C16H17N7S/c1-10-14(11(2)21-22-16(17)18)24-15(20-10)12-3-5-13(6-4-12)23-8-7-19-9-23/h3-9H,1-2H3,(H4,17,18,22)/b21-11+ |
| InChIKey | UAGRRJRBSCUIMV-SRZZPIQSSA-N |
| XLogP | 2.30 |
| TPSA | 107.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.43 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|