C21H20N8O — CID 76562322
5-[N-(diaminomethylideneamino)-C-methylcarbonimidoyl]-N-(4-imidazol-1-ylphenyl)-1H-indole-2-carboxamide (PubChem CID 76562322) has the molecular formula C21H20N8O and a molecular weight of 400.45 g/mol. Its IUPAC name is 5-[N-(diaminomethylideneamino)-C-methylcarbonimidoyl]-N-(4-imidazol-1-ylphenyl)-1H-indole-2-carboxamide.
| Compound Name | 5-[N-(diaminomethylideneamino)-C-methylcarbonimidoyl]-N-(4-imidazol-1-ylphenyl)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 76562322 |
| Molecular Formula | C21H20N8O |
| Molecular Weight | 400.45 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | 5-[N-(diaminomethylideneamino)-C-methylcarbonimidoyl]-N-(4-imidazol-1-ylphenyl)-1H-indole-2-carboxamide |
| SMILES | CC(=NN=C(N)N)c1ccc2[nH]c(C(=O)Nc3ccc(-n4ccnc4)cc3)cc2c1 |
| InChI | InChI=1S/C21H20N8O/c1-13(27-28-21(22)23)14-2-7-18-15(10-14)11-19(26-18)20(30)25-16-3-5-17(6-4-16)29-9-8-24-12-29/h2-12,26H,1H3,(H,25,30)(H4,22,23,28) |
| InChIKey | KUXFASFFHMMXPR-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 139.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.45 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|