C22H24N6O3 — CID 172973075
6-acetamido-N-[4-[(E)-N-(1-aminoethylideneamino)-C-methylcarbonimidoyl]phenyl]-5-methoxy-1H-indole-2-carboxamide (PubChem CID 172973075) has the molecular formula C22H24N6O3 and a molecular weight of 420.47 g/mol. Its IUPAC name is 6-acetamido-N-[4-[(E)-N-(1-aminoethylideneamino)-C-methylcarbonimidoyl]phenyl]-5-methoxy-1H-indole-2-carboxamide.
| Compound Name | 6-acetamido-N-[4-[(E)-N-(1-aminoethylideneamino)-C-methylcarbonimidoyl]phenyl]-5-methoxy-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 172973075 |
| Molecular Formula | C22H24N6O3 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | 6-acetamido-N-[4-[(E)-N-(1-aminoethylideneamino)-C-methylcarbonimidoyl]phenyl]-5-methoxy-1H-indole-2-carboxamide |
| SMILES | COc1cc2cc(C(=O)Nc3ccc(/C(C)=N/N=C(C)N)cc3)[nH]c2cc1NC(C)=O |
| InChI | InChI=1S/C22H24N6O3/c1-12(27-28-13(2)23)15-5-7-17(8-6-15)25-22(30)20-9-16-10-21(31-4)19(24-14(3)29)11-18(16)26-20/h5-11,26H,1-4H3,(H2,23,28)(H,24,29)(H,25,30)/b27-12+ |
| InChIKey | CAUPHRFQFWUHQI-KKMKTNMSSA-N |
| XLogP | 3.49 |
| TPSA | 133.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|