C20H20N4O3 — CID 90854337
N-[4-[(Z)-N-(1-aminoethylideneamino)-C-methylcarbonimidoyl]phenyl]-5-methoxy-1-benzofuran-2-carboxamide (PubChem CID 90854337) has the molecular formula C20H20N4O3 and a molecular weight of 364.41 g/mol. Its IUPAC name is N-[4-[(Z)-N-(1-aminoethylideneamino)-C-methylcarbonimidoyl]phenyl]-5-methoxy-1-benzofuran-2-carboxamide.
| Compound Name | N-[4-[(Z)-N-(1-aminoethylideneamino)-C-methylcarbonimidoyl]phenyl]-5-methoxy-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 90854337 |
| Molecular Formula | C20H20N4O3 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | N-[4-[(Z)-N-(1-aminoethylideneamino)-C-methylcarbonimidoyl]phenyl]-5-methoxy-1-benzofuran-2-carboxamide |
| SMILES | COc1ccc2oc(C(=O)Nc3ccc(/C(C)=N\N=C(C)N)cc3)cc2c1 |
| InChI | InChI=1S/C20H20N4O3/c1-12(23-24-13(2)21)14-4-6-16(7-5-14)22-20(25)19-11-15-10-17(26-3)8-9-18(15)27-19/h4-11H,1-3H3,(H2,21,24)(H,22,25)/b23-12- |
| InChIKey | GXOCWJLMVUCNMI-FMCGGJTJSA-N |
| XLogP | 3.79 |
| TPSA | 102.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|