C16H12ClNO4 — CID 126194096
N-(4-chloro-2-hydroxyphenyl)-5-methoxy-1-benzofuran-2-carboxamide (PubChem CID 126194096) has the molecular formula C16H12ClNO4 and a molecular weight of 317.73 g/mol. Its IUPAC name is N-(4-chloro-2-hydroxyphenyl)-5-methoxy-1-benzofuran-2-carboxamide.
| Compound Name | N-(4-chloro-2-hydroxyphenyl)-5-methoxy-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 126194096 |
| Molecular Formula | C16H12ClNO4 |
| Molecular Weight | 317.73 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | N-(4-chloro-2-hydroxyphenyl)-5-methoxy-1-benzofuran-2-carboxamide |
| SMILES | COc1ccc2oc(C(=O)Nc3ccc(Cl)cc3O)cc2c1 |
| InChI | InChI=1S/C16H12ClNO4/c1-21-11-3-5-14-9(6-11)7-15(22-14)16(20)18-12-4-2-10(17)8-13(12)19/h2-8,19H,1H3,(H,18,20) |
| InChIKey | VBRAABHAYMAZTN-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.73 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|