C19H19N7O3 — CID 89211804
N-[4-[(E)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]-5-methoxy-7-nitroso-1H-indole-2-carboxamide (PubChem CID 89211804) has the molecular formula C19H19N7O3 and a molecular weight of 393.41 g/mol. Its IUPAC name is N-[4-[(E)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]-5-methoxy-7-nitroso-1H-indole-2-carboxamide.
| Compound Name | N-[4-[(E)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]-5-methoxy-7-nitroso-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 89211804 |
| Molecular Formula | C19H19N7O3 |
| Molecular Weight | 393.41 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | N-[4-[(E)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]-5-methoxy-7-nitroso-1H-indole-2-carboxamide |
| SMILES | COc1cc(N=O)c2[nH]c(C(=O)Nc3ccc(/C(C)=N/N=C(N)N)cc3)cc2c1 |
| InChI | InChI=1S/C19H19N7O3/c1-10(24-25-19(20)21)11-3-5-13(6-4-11)22-18(27)16-8-12-7-14(29-2)9-15(26-28)17(12)23-16/h3-9,23H,1-2H3,(H,22,27)(H4,20,21,25)/b24-10+ |
| InChIKey | ZXWBZTASCLHZBC-YSURURNPSA-N |
| XLogP | 2.82 |
| TPSA | 160.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.41 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|