C18H17IN7O3+ — CID 177365095
[2-[[4-[(E)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]carbamoyl]-1H-indol-7-yl]-iodosyl-oxoazanium (PubChem CID 177365095) has the molecular formula C18H17IN7O3+ and a molecular weight of 506.28 g/mol. Its IUPAC name is [2-[[4-[(E)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]carbamoyl]-1H-indol-7-yl]-iodosyl-oxoazanium.
| Compound Name | [2-[[4-[(E)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]carbamoyl]-1H-indol-7-yl]-iodosyl-oxoazanium |
|---|---|
| PubChem CID | 177365095 |
| Molecular Formula | C18H17IN7O3+ |
| Molecular Weight | 506.28 g/mol |
| Exact Mass | 506.04 |
| IUPAC Name | [2-[[4-[(E)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]carbamoyl]-1H-indol-7-yl]-iodosyl-oxoazanium |
| SMILES | C/C(=N\N=C(N)N)c1ccc(NC(=O)c2cc3cccc([N+](=O)I=O)c3[nH]2)cc1 |
| InChI | InChI=1S/C18H16IN7O3/c1-10(24-25-18(20)21)11-5-7-13(8-6-11)22-17(27)14-9-12-3-2-4-15(16(12)23-14)26(29)19-28/h2-9H,1H3,(H5-,20,21,22,23,24,25,27,28,29)/p+1 |
| InChIKey | TYIXYEOMYJAKDS-UHFFFAOYSA-O |
| XLogP | 3.06 |
| TPSA | 158.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.28 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|