C21H23N7O3 — CID 74391164
6-acetamido-N-[4-[N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]-5-methoxy-1H-indole-2-carboxamide (PubChem CID 74391164) has the molecular formula C21H23N7O3 and a molecular weight of 421.46 g/mol. Its IUPAC name is 6-acetamido-N-[4-[N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]-5-methoxy-1H-indole-2-carboxamide.
| Compound Name | 6-acetamido-N-[4-[N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]-5-methoxy-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 74391164 |
| Molecular Formula | C21H23N7O3 |
| Molecular Weight | 421.46 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | 6-acetamido-N-[4-[N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]-5-methoxy-1H-indole-2-carboxamide |
| SMILES | COc1cc2cc(C(=O)Nc3ccc(C(C)=NN=C(N)N)cc3)[nH]c2cc1NC(C)=O |
| InChI | InChI=1S/C21H23N7O3/c1-11(27-28-21(22)23)13-4-6-15(7-5-13)25-20(30)18-8-14-9-19(31-3)17(24-12(2)29)10-16(14)26-18/h4-10,26H,1-3H3,(H,24,29)(H,25,30)(H4,22,23,28) |
| InChIKey | JJUAXWIGZIIJNV-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 159.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.46 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|