C19H20N6O — CID 123184653
N-[4-[(Z)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]-6-methyl-1H-indole-2-carboxamide (PubChem CID 123184653) has the molecular formula C19H20N6O and a molecular weight of 348.41 g/mol. Its IUPAC name is N-[4-[(Z)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]-6-methyl-1H-indole-2-carboxamide.
| Compound Name | N-[4-[(Z)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]-6-methyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 123184653 |
| Molecular Formula | C19H20N6O |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | N-[4-[(Z)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]-6-methyl-1H-indole-2-carboxamide |
| SMILES | C/C(=N/N=C(N)N)c1ccc(NC(=O)c2cc3ccc(C)cc3[nH]2)cc1 |
| InChI | InChI=1S/C19H20N6O/c1-11-3-4-14-10-17(23-16(14)9-11)18(26)22-15-7-5-13(6-8-15)12(2)24-25-19(20)21/h3-10,23H,1-2H3,(H,22,26)(H4,20,21,25)/b24-12- |
| InChIKey | UQEVWWNWCGGABT-MSXFZWOLSA-N |
| XLogP | 2.73 |
| TPSA | 121.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|