C21H24N6O — CID 91510178
N-[4-[(Z)-N-(1-aminoethylideneamino)-C-methylcarbonimidoyl]phenyl]-6-(ethylamino)-1H-indole-2-carboxamide (PubChem CID 91510178) has the molecular formula C21H24N6O and a molecular weight of 376.46 g/mol. Its IUPAC name is N-[4-[(Z)-N-(1-aminoethylideneamino)-C-methylcarbonimidoyl]phenyl]-6-(ethylamino)-1H-indole-2-carboxamide.
| Compound Name | N-[4-[(Z)-N-(1-aminoethylideneamino)-C-methylcarbonimidoyl]phenyl]-6-(ethylamino)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 91510178 |
| Molecular Formula | C21H24N6O |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | N-[4-[(Z)-N-(1-aminoethylideneamino)-C-methylcarbonimidoyl]phenyl]-6-(ethylamino)-1H-indole-2-carboxamide |
| SMILES | CCNc1ccc2cc(C(=O)Nc3ccc(/C(C)=N\N=C(C)N)cc3)[nH]c2c1 |
| InChI | InChI=1S/C21H24N6O/c1-4-23-18-10-7-16-11-20(25-19(16)12-18)21(28)24-17-8-5-15(6-9-17)13(2)26-27-14(3)22/h5-12,23,25H,4H2,1-3H3,(H2,22,27)(H,24,28)/b26-13- |
| InChIKey | ZYEBUNBWNXEUJZ-ZMFRSBBQSA-N |
| XLogP | 3.95 |
| TPSA | 107.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|