C19H20N8O4 — CID 25132438
N-[4-[(E)-N-[[(Z)-C-aminocarbonohydrazonoyl]amino]-C-methylcarbonimidoyl]phenyl]-5-methoxy-7-nitro-1H-indole-2-carboxamide (PubChem CID 25132438) has the molecular formula C19H20N8O4 and a molecular weight of 424.42 g/mol. Its IUPAC name is N-[4-[(E)-N-[[(Z)-C-aminocarbonohydrazonoyl]amino]-C-methylcarbonimidoyl]phenyl]-5-methoxy-7-nitro-1H-indole-2-carboxamide.
| Compound Name | N-[4-[(E)-N-[[(Z)-C-aminocarbonohydrazonoyl]amino]-C-methylcarbonimidoyl]phenyl]-5-methoxy-7-nitro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 25132438 |
| Molecular Formula | C19H20N8O4 |
| Molecular Weight | 424.42 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | N-[4-[(E)-N-[[(Z)-C-aminocarbonohydrazonoyl]amino]-C-methylcarbonimidoyl]phenyl]-5-methoxy-7-nitro-1H-indole-2-carboxamide |
| SMILES | COc1cc([N+](=O)[O-])c2[nH]c(C(=O)Nc3ccc(/C(C)=N/N/C(N)=N\N)cc3)cc2c1 |
| InChI | InChI=1S/C19H20N8O4/c1-10(25-26-19(20)24-21)11-3-5-13(6-4-11)22-18(28)15-8-12-7-14(31-2)9-16(27(29)30)17(12)23-15/h3-9,23H,21H2,1-2H3,(H,22,28)(H3,20,24,26)/b25-10+ |
| InChIKey | XIFUPXIAXGBOCE-KIBLKLHPSA-N |
| XLogP | 1.84 |
| TPSA | 186.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.42 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|