C23H27N7O2 — CID 123565010
5-[(E)-N-[[amino-(hydroxyamino)methylidene]amino]-C-methylcarbonimidoyl]-N-(4-piperidin-1-ylphenyl)-1H-indole-2-carboxamide (PubChem CID 123565010) has the molecular formula C23H27N7O2 and a molecular weight of 433.52 g/mol. Its IUPAC name is 5-[(E)-N-[[amino-(hydroxyamino)methylidene]amino]-C-methylcarbonimidoyl]-N-(4-piperidin-1-ylphenyl)-1H-indole-2-carboxamide.
| Compound Name | 5-[(E)-N-[[amino-(hydroxyamino)methylidene]amino]-C-methylcarbonimidoyl]-N-(4-piperidin-1-ylphenyl)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 123565010 |
| Molecular Formula | C23H27N7O2 |
| Molecular Weight | 433.52 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | 5-[(E)-N-[[amino-(hydroxyamino)methylidene]amino]-C-methylcarbonimidoyl]-N-(4-piperidin-1-ylphenyl)-1H-indole-2-carboxamide |
| SMILES | C/C(=N\N=C(N)NO)c1ccc2[nH]c(C(=O)Nc3ccc(N4CCCCC4)cc3)cc2c1 |
| InChI | InChI=1S/C23H27N7O2/c1-15(27-28-23(24)29-32)16-5-10-20-17(13-16)14-21(26-20)22(31)25-18-6-8-19(9-7-18)30-11-3-2-4-12-30/h5-10,13-14,26,32H,2-4,11-12H2,1H3,(H,25,31)(H3,24,28,29)/b27-15+ |
| InChIKey | NWDPEPCOICKDDE-JFLMPSFJSA-N |
| XLogP | 3.43 |
| TPSA | 131.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.52 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|