C22H24N4O2 — CID 51129960
N-[4-(4-carbamoylpiperidin-1-yl)phenyl]-6-methyl-1H-indole-2-carboxamide (PubChem CID 51129960) has the molecular formula C22H24N4O2 and a molecular weight of 376.46 g/mol. Its IUPAC name is N-[4-(4-carbamoylpiperidin-1-yl)phenyl]-6-methyl-1H-indole-2-carboxamide.
| Compound Name | N-[4-(4-carbamoylpiperidin-1-yl)phenyl]-6-methyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 51129960 |
| Molecular Formula | C22H24N4O2 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | N-[4-(4-carbamoylpiperidin-1-yl)phenyl]-6-methyl-1H-indole-2-carboxamide |
| SMILES | Cc1ccc2cc(C(=O)Nc3ccc(N4CCC(C(N)=O)CC4)cc3)[nH]c2c1 |
| InChI | InChI=1S/C22H24N4O2/c1-14-2-3-16-13-20(25-19(16)12-14)22(28)24-17-4-6-18(7-5-17)26-10-8-15(9-11-26)21(23)27/h2-7,12-13,15,25H,8-11H2,1H3,(H2,23,27)(H,24,28) |
| InChIKey | ZKNVFYINBLXIRR-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|