C10H13N7S — CID 140639559
2-[1-[4-methyl-2-(1H-pyrazol-5-yl)-1,3-thiazol-5-yl]ethylideneamino]guanidine (PubChem CID 140639559) has the molecular formula C10H13N7S and a molecular weight of 263.33 g/mol. Its IUPAC name is 2-[1-[4-methyl-2-(1H-pyrazol-5-yl)-1,3-thiazol-5-yl]ethylideneamino]guanidine.
| Compound Name | 2-[1-[4-methyl-2-(1H-pyrazol-5-yl)-1,3-thiazol-5-yl]ethylideneamino]guanidine |
|---|---|
| PubChem CID | 140639559 |
| Molecular Formula | C10H13N7S |
| Molecular Weight | 263.33 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | 2-[1-[4-methyl-2-(1H-pyrazol-5-yl)-1,3-thiazol-5-yl]ethylideneamino]guanidine |
| SMILES | CC(=NN=C(N)N)c1sc(-c2ccn[nH]2)nc1C |
| InChI | InChI=1S/C10H13N7S/c1-5-8(6(2)15-17-10(11)12)18-9(14-5)7-3-4-13-16-7/h3-4H,1-2H3,(H,13,16)(H4,11,12,17) |
| InChIKey | HYGFZVQJYBCGBD-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 118.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.33 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|