C21H23N7OS — CID 156787895
2-[1-[2-[2-[[4-(4-methoxyphenyl)phenyl]methylidene]hydrazinyl]-4-methyl-1,3-thiazol-5-yl]ethylideneamino]guanidine (PubChem CID 156787895) has the molecular formula C21H23N7OS and a molecular weight of 421.53 g/mol. Its IUPAC name is 2-[1-[2-[2-[[4-(4-methoxyphenyl)phenyl]methylidene]hydrazinyl]-4-methyl-1,3-thiazol-5-yl]ethylideneamino]guanidine.
| Compound Name | 2-[1-[2-[2-[[4-(4-methoxyphenyl)phenyl]methylidene]hydrazinyl]-4-methyl-1,3-thiazol-5-yl]ethylideneamino]guanidine |
|---|---|
| PubChem CID | 156787895 |
| Molecular Formula | C21H23N7OS |
| Molecular Weight | 421.53 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | 2-[1-[2-[2-[[4-(4-methoxyphenyl)phenyl]methylidene]hydrazinyl]-4-methyl-1,3-thiazol-5-yl]ethylideneamino]guanidine |
| SMILES | COc1ccc(-c2ccc(C=NNc3nc(C)c(C(C)=NN=C(N)N)s3)cc2)cc1 |
| InChI | InChI=1S/C21H23N7OS/c1-13-19(14(2)26-27-20(22)23)30-21(25-13)28-24-12-15-4-6-16(7-5-15)17-8-10-18(29-3)11-9-17/h4-12H,1-3H3,(H,25,28)(H4,22,23,27) |
| InChIKey | BLSJGDSJYFUMRX-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.53 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|