C15H18BrN3O3S — CID 2848587
1-[2-[2-[(2,5-dimethoxyphenyl)methylidene]hydrazinyl]-4-methyl-1,3-thiazol-5-yl]ethanone;hydrobromide (PubChem CID 2848587) has the molecular formula C15H18BrN3O3S and a molecular weight of 400.30 g/mol. Its IUPAC name is 1-[2-[2-[(2,5-dimethoxyphenyl)methylidene]hydrazinyl]-4-methyl-1,3-thiazol-5-yl]ethanone;hydrobromide.
| Compound Name | 1-[2-[2-[(2,5-dimethoxyphenyl)methylidene]hydrazinyl]-4-methyl-1,3-thiazol-5-yl]ethanone;hydrobromide |
|---|---|
| PubChem CID | 2848587 |
| Molecular Formula | C15H18BrN3O3S |
| Molecular Weight | 400.30 g/mol |
| Exact Mass | 399.03 |
| IUPAC Name | 1-[2-[2-[(2,5-dimethoxyphenyl)methylidene]hydrazinyl]-4-methyl-1,3-thiazol-5-yl]ethanone;hydrobromide |
| SMILES | Br.COc1ccc(OC)c(C=NNc2nc(C)c(C(C)=O)s2)c1 |
| InChI | InChI=1S/C15H17N3O3S.BrH/c1-9-14(10(2)19)22-15(17-9)18-16-8-11-7-12(20-3)5-6-13(11)21-4;/h5-8H,1-4H3,(H,17,18);1H |
| InChIKey | IECVALJIUAZINC-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.30 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|