C21H30N6OS2 — CID 155532618
2-[(E)-1-[4-methyl-2-[4-[5-(1,3-thiazolidin-3-yl)pentoxy]phenyl]-1,3-thiazol-5-yl]ethylideneamino]guanidine (PubChem CID 155532618) has the molecular formula C21H30N6OS2 and a molecular weight of 446.65 g/mol. Its IUPAC name is 2-[(E)-1-[4-methyl-2-[4-[5-(1,3-thiazolidin-3-yl)pentoxy]phenyl]-1,3-thiazol-5-yl]ethylideneamino]guanidine.
| Compound Name | 2-[(E)-1-[4-methyl-2-[4-[5-(1,3-thiazolidin-3-yl)pentoxy]phenyl]-1,3-thiazol-5-yl]ethylideneamino]guanidine |
|---|---|
| PubChem CID | 155532618 |
| Molecular Formula | C21H30N6OS2 |
| Molecular Weight | 446.65 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | 2-[(E)-1-[4-methyl-2-[4-[5-(1,3-thiazolidin-3-yl)pentoxy]phenyl]-1,3-thiazol-5-yl]ethylideneamino]guanidine |
| SMILES | C/C(=N\N=C(N)N)c1sc(-c2ccc(OCCCCCN3CCSC3)cc2)nc1C |
| InChI | InChI=1S/C21H30N6OS2/c1-15-19(16(2)25-26-21(22)23)30-20(24-15)17-6-8-18(9-7-17)28-12-5-3-4-10-27-11-13-29-14-27/h6-9H,3-5,10-14H2,1-2H3,(H4,22,23,26)/b25-16+ |
| InChIKey | DZZGPFBKWRWSES-PCLIKHOPSA-N |
| XLogP | 3.67 |
| TPSA | 102.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.65 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|