C26H38N6OS — CID 155521973
2-[(E)-1-[2-[4-[4-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)butoxy]phenyl]-4-methyl-1,3-thiazol-5-yl]ethylideneamino]guanidine (PubChem CID 155521973) has the molecular formula C26H38N6OS and a molecular weight of 482.70 g/mol. Its IUPAC name is 2-[(E)-1-[2-[4-[4-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)butoxy]phenyl]-4-methyl-1,3-thiazol-5-yl]ethylideneamino]guanidine.
| Compound Name | 2-[(E)-1-[2-[4-[4-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)butoxy]phenyl]-4-methyl-1,3-thiazol-5-yl]ethylideneamino]guanidine |
|---|---|
| PubChem CID | 155521973 |
| Molecular Formula | C26H38N6OS |
| Molecular Weight | 482.70 g/mol |
| Exact Mass | 482.28 |
| IUPAC Name | 2-[(E)-1-[2-[4-[4-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)butoxy]phenyl]-4-methyl-1,3-thiazol-5-yl]ethylideneamino]guanidine |
| SMILES | C/C(=N\N=C(N)N)c1sc(-c2ccc(OCCCCN3CCC4CCCCC4C3)cc2)nc1C |
| InChI | InChI=1S/C26H38N6OS/c1-18-24(19(2)30-31-26(27)28)34-25(29-18)21-9-11-23(12-10-21)33-16-6-5-14-32-15-13-20-7-3-4-8-22(20)17-32/h9-12,20,22H,3-8,13-17H2,1-2H3,(H4,27,28,31)/b30-19+ |
| InChIKey | AMICXDULWDSGFX-NDZAJKAJSA-N |
| XLogP | 4.79 |
| TPSA | 102.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.70 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|