C20H15NO5 — CID 135492530
phenyl 5-[(2,5-dihydroxyphenyl)methylideneamino]-2-hydroxybenzoate (PubChem CID 135492530) has the molecular formula C20H15NO5 and a molecular weight of 349.34 g/mol. Its IUPAC name is phenyl 5-[(2,5-dihydroxyphenyl)methylideneamino]-2-hydroxybenzoate.
| Compound Name | phenyl 5-[(2,5-dihydroxyphenyl)methylideneamino]-2-hydroxybenzoate |
|---|---|
| PubChem CID | 135492530 |
| Molecular Formula | C20H15NO5 |
| Molecular Weight | 349.34 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | phenyl 5-[(2,5-dihydroxyphenyl)methylideneamino]-2-hydroxybenzoate |
| SMILES | O=C(Oc1ccccc1)c1cc(/N=C/c2cc(O)ccc2O)ccc1O |
| InChI | InChI=1S/C20H15NO5/c22-15-7-9-18(23)13(10-15)12-21-14-6-8-19(24)17(11-14)20(25)26-16-4-2-1-3-5-16/h1-12,22-24H/b21-12+ |
| InChIKey | GPLRYQZLEFAVNT-CIAFOILYSA-N |
| XLogP | 3.77 |
| TPSA | 99.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.34 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|