C25H17N3O6 — CID 135761000
N-[4-hydroxy-3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]-5-(2-nitrophenyl)furan-2-carboxamide (PubChem CID 135761000) has the molecular formula C25H17N3O6 and a molecular weight of 455.43 g/mol. Its IUPAC name is N-[4-hydroxy-3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]-5-(2-nitrophenyl)furan-2-carboxamide.
| Compound Name | N-[4-hydroxy-3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]-5-(2-nitrophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 135761000 |
| Molecular Formula | C25H17N3O6 |
| Molecular Weight | 455.43 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | N-[4-hydroxy-3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]-5-(2-nitrophenyl)furan-2-carboxamide |
| SMILES | Cc1ccc2oc(-c3cc(NC(=O)c4ccc(-c5ccccc5[N+](=O)[O-])o4)ccc3O)nc2c1 |
| InChI | InChI=1S/C25H17N3O6/c1-14-6-9-22-18(12-14)27-25(34-22)17-13-15(7-8-20(17)29)26-24(30)23-11-10-21(33-23)16-4-2-3-5-19(16)28(31)32/h2-13,29H,1H3,(H,26,30) |
| InChIKey | KOELWBWISODNES-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 131.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.43 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|