C27H21N3O5 — CID 1495055
N-[5-(5,7-dimethyl-1,3-benzoxazol-2-yl)-2-methylphenyl]-5-(2-nitrophenyl)furan-2-carboxamide (PubChem CID 1495055) has the molecular formula C27H21N3O5 and a molecular weight of 467.48 g/mol. Its IUPAC name is N-[5-(5,7-dimethyl-1,3-benzoxazol-2-yl)-2-methylphenyl]-5-(2-nitrophenyl)furan-2-carboxamide.
| Compound Name | N-[5-(5,7-dimethyl-1,3-benzoxazol-2-yl)-2-methylphenyl]-5-(2-nitrophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 1495055 |
| Molecular Formula | C27H21N3O5 |
| Molecular Weight | 467.48 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | N-[5-(5,7-dimethyl-1,3-benzoxazol-2-yl)-2-methylphenyl]-5-(2-nitrophenyl)furan-2-carboxamide |
| SMILES | Cc1cc(C)c2oc(-c3ccc(C)c(NC(=O)c4ccc(-c5ccccc5[N+](=O)[O-])o4)c3)nc2c1 |
| InChI | InChI=1S/C27H21N3O5/c1-15-12-17(3)25-21(13-15)29-27(35-25)18-9-8-16(2)20(14-18)28-26(31)24-11-10-23(34-24)19-6-4-5-7-22(19)30(32)33/h4-14H,1-3H3,(H,28,31) |
| InChIKey | CVEBIGCEBOQMQY-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 111.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.48 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|