C25H20FN5O5S — CID 21167555
N-[[2-(2-fluorophenyl)-1,3-benzoxazol-5-yl]carbamothioyl]-2-morpholin-4-yl-5-nitrobenzamide (PubChem CID 21167555) has the molecular formula C25H20FN5O5S and a molecular weight of 521.53 g/mol. Its IUPAC name is N-[[2-(2-fluorophenyl)-1,3-benzoxazol-5-yl]carbamothioyl]-2-morpholin-4-yl-5-nitrobenzamide.
| Compound Name | N-[[2-(2-fluorophenyl)-1,3-benzoxazol-5-yl]carbamothioyl]-2-morpholin-4-yl-5-nitrobenzamide |
|---|---|
| PubChem CID | 21167555 |
| Molecular Formula | C25H20FN5O5S |
| Molecular Weight | 521.53 g/mol |
| Exact Mass | 521.12 |
| IUPAC Name | N-[[2-(2-fluorophenyl)-1,3-benzoxazol-5-yl]carbamothioyl]-2-morpholin-4-yl-5-nitrobenzamide |
| SMILES | O=C(NC(=S)Nc1ccc2oc(-c3ccccc3F)nc2c1)c1cc([N+](=O)[O-])ccc1N1CCOCC1 |
| InChI | InChI=1S/C25H20FN5O5S/c26-19-4-2-1-3-17(19)24-28-20-13-15(5-8-22(20)36-24)27-25(37)29-23(32)18-14-16(31(33)34)6-7-21(18)30-9-11-35-12-10-30/h1-8,13-14H,9-12H2,(H2,27,29,32,37) |
| InChIKey | YWSKVWQGJDFFBM-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 122.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.53 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|