C16H11ClN2O — CID 142139537
3-(1,3-benzoxazol-2-yl)-4-chloro-N-prop-2-ynylaniline (PubChem CID 142139537) has the molecular formula C16H11ClN2O and a molecular weight of 282.73 g/mol. Its IUPAC name is 3-(1,3-benzoxazol-2-yl)-4-chloro-N-prop-2-ynylaniline.
| Compound Name | 3-(1,3-benzoxazol-2-yl)-4-chloro-N-prop-2-ynylaniline |
|---|---|
| PubChem CID | 142139537 |
| Molecular Formula | C16H11ClN2O |
| Molecular Weight | 282.73 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | 3-(1,3-benzoxazol-2-yl)-4-chloro-N-prop-2-ynylaniline |
| SMILES | C#CCNc1ccc(Cl)c(-c2nc3ccccc3o2)c1 |
| InChI | InChI=1S/C16H11ClN2O/c1-2-9-18-11-7-8-13(17)12(10-11)16-19-14-5-3-4-6-15(14)20-16/h1,3-8,10,18H,9H2 |
| InChIKey | VDEIGMFLSXCPJJ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.73 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|