C13H16N4O2 — CID 108519474
N'-(4-cyanophenyl)-N-[2-(dimethylamino)ethyl]oxamide (PubChem CID 108519474) has the molecular formula C13H16N4O2 and a molecular weight of 260.30 g/mol. Its IUPAC name is N'-(4-cyanophenyl)-N-[2-(dimethylamino)ethyl]oxamide.
| Compound Name | N'-(4-cyanophenyl)-N-[2-(dimethylamino)ethyl]oxamide |
|---|---|
| PubChem CID | 108519474 |
| Molecular Formula | C13H16N4O2 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | N'-(4-cyanophenyl)-N-[2-(dimethylamino)ethyl]oxamide |
| SMILES | CN(C)CCNC(=O)C(=O)Nc1ccc(C#N)cc1 |
| InChI | InChI=1S/C13H16N4O2/c1-17(2)8-7-15-12(18)13(19)16-11-5-3-10(9-14)4-6-11/h3-6H,7-8H2,1-2H3,(H,15,18)(H,16,19) |
| InChIKey | YNFOLOYNJXLENR-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 85.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|