C16H15N3O5S — CID 22785047
(E)-4-[4-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]sulfanylanilino]-4-oxobut-2-enoic acid (PubChem CID 22785047) has the molecular formula C16H15N3O5S and a molecular weight of 361.38 g/mol. Its IUPAC name is (E)-4-[4-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]sulfanylanilino]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[4-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]sulfanylanilino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 22785047 |
| Molecular Formula | C16H15N3O5S |
| Molecular Weight | 361.38 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | (E)-4-[4-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]sulfanylanilino]-4-oxobut-2-enoic acid |
| SMILES | Cc1cc(NC(=O)CSc2ccc(NC(=O)/C=C/C(=O)O)cc2)no1 |
| InChI | InChI=1S/C16H15N3O5S/c1-10-8-13(19-24-10)18-15(21)9-25-12-4-2-11(3-5-12)17-14(20)6-7-16(22)23/h2-8H,9H2,1H3,(H,17,20)(H,22,23)(H,18,19,21)/b7-6+ |
| InChIKey | VYDAWAWJYROLGH-VOTSOKGWSA-N |
| XLogP | 2.29 |
| TPSA | 121.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.38 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|