C32H24N2O6S — CID 22785130
4-[4-[2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxo-1-phenylethyl]sulfanylanilino]-4-oxobutanoic acid (PubChem CID 22785130) has the molecular formula C32H24N2O6S and a molecular weight of 564.62 g/mol. Its IUPAC name is 4-[4-[2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxo-1-phenylethyl]sulfanylanilino]-4-oxobutanoic acid.
| Compound Name | 4-[4-[2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxo-1-phenylethyl]sulfanylanilino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 22785130 |
| Molecular Formula | C32H24N2O6S |
| Molecular Weight | 564.62 g/mol |
| Exact Mass | 564.14 |
| IUPAC Name | 4-[4-[2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxo-1-phenylethyl]sulfanylanilino]-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)Nc1ccc(SC(C(=O)Nc2cccc3c2C(=O)c2ccccc2C3=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C32H24N2O6S/c35-26(17-18-27(36)37)33-20-13-15-21(16-14-20)41-31(19-7-2-1-3-8-19)32(40)34-25-12-6-11-24-28(25)30(39)23-10-5-4-9-22(23)29(24)38/h1-16,31H,17-18H2,(H,33,35)(H,34,40)(H,36,37) |
| InChIKey | LKDCHZJRJUTMTA-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 129.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.62 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|