C25H25ClFN3O3 — CID 69344827
N-[5-[4-[(3-chloro-4-fluorophenyl)carbamoylamino]phenyl]pentyl]-2-hydroxybenzamide (PubChem CID 69344827) has the molecular formula C25H25ClFN3O3 and a molecular weight of 469.94 g/mol. Its IUPAC name is N-[5-[4-[(3-chloro-4-fluorophenyl)carbamoylamino]phenyl]pentyl]-2-hydroxybenzamide.
| Compound Name | N-[5-[4-[(3-chloro-4-fluorophenyl)carbamoylamino]phenyl]pentyl]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 69344827 |
| Molecular Formula | C25H25ClFN3O3 |
| Molecular Weight | 469.94 g/mol |
| Exact Mass | 469.16 |
| IUPAC Name | N-[5-[4-[(3-chloro-4-fluorophenyl)carbamoylamino]phenyl]pentyl]-2-hydroxybenzamide |
| SMILES | O=C(Nc1ccc(CCCCCNC(=O)c2ccccc2O)cc1)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C25H25ClFN3O3/c26-21-16-19(13-14-22(21)27)30-25(33)29-18-11-9-17(10-12-18)6-2-1-5-15-28-24(32)20-7-3-4-8-23(20)31/h3-4,7-14,16,31H,1-2,5-6,15H2,(H,28,32)(H2,29,30,33) |
| InChIKey | YJJQOOZPJCNXTC-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.94 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|