C21H19BrN2O3 — CID 1078848
2-bromo-N-[(1S)-2-(2,6-dimethylanilino)-1-(furan-2-yl)-2-oxoethyl]benzamide (PubChem CID 1078848) has the molecular formula C21H19BrN2O3 and a molecular weight of 427.30 g/mol. Its IUPAC name is 2-bromo-N-[(1S)-2-(2,6-dimethylanilino)-1-(furan-2-yl)-2-oxoethyl]benzamide.
| Compound Name | 2-bromo-N-[(1S)-2-(2,6-dimethylanilino)-1-(furan-2-yl)-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 1078848 |
| Molecular Formula | C21H19BrN2O3 |
| Molecular Weight | 427.30 g/mol |
| Exact Mass | 426.06 |
| IUPAC Name | 2-bromo-N-[(1S)-2-(2,6-dimethylanilino)-1-(furan-2-yl)-2-oxoethyl]benzamide |
| SMILES | Cc1cccc(C)c1NC(=O)[C@@H](NC(=O)c1ccccc1Br)c1ccco1 |
| InChI | InChI=1S/C21H19BrN2O3/c1-13-7-5-8-14(2)18(13)23-21(26)19(17-11-6-12-27-17)24-20(25)15-9-3-4-10-16(15)22/h3-12,19H,1-2H3,(H,23,26)(H,24,25)/t19-/m0/s1 |
| InChIKey | GCJUDCFKWWKJAV-IBGZPJMESA-N |
| XLogP | 4.77 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.30 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |