C24H22FN3O4 — CID 57348887
N-(2,6-dimethylphenyl)-2-[[2-(2-fluorophenyl)-2-oxoethyl]amino]-2-(4-nitrophenyl)acetamide (PubChem CID 57348887) has the molecular formula C24H22FN3O4 and a molecular weight of 435.46 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-2-[[2-(2-fluorophenyl)-2-oxoethyl]amino]-2-(4-nitrophenyl)acetamide.
| Compound Name | N-(2,6-dimethylphenyl)-2-[[2-(2-fluorophenyl)-2-oxoethyl]amino]-2-(4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 57348887 |
| Molecular Formula | C24H22FN3O4 |
| Molecular Weight | 435.46 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | N-(2,6-dimethylphenyl)-2-[[2-(2-fluorophenyl)-2-oxoethyl]amino]-2-(4-nitrophenyl)acetamide |
| SMILES | Cc1cccc(C)c1NC(=O)C(NCC(=O)c1ccccc1F)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C24H22FN3O4/c1-15-6-5-7-16(2)22(15)27-24(30)23(17-10-12-18(13-11-17)28(31)32)26-14-21(29)19-8-3-4-9-20(19)25/h3-13,23,26H,14H2,1-2H3,(H,27,30) |
| InChIKey | TYHCNQSTCBPABT-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.46 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|