C36H26F6N4O8 — CID 139041379
2-[(2S,3S,4S)-2,3,4-trifluoro-4-(4-nitrophenyl)butyl]isoindole-1,3-dione (PubChem CID 139041379) has the molecular formula C36H26F6N4O8 and a molecular weight of 756.61 g/mol. Its IUPAC name is 2-[(2S,3S,4S)-2,3,4-trifluoro-4-(4-nitrophenyl)butyl]isoindole-1,3-dione.
| Compound Name | 2-[(2S,3S,4S)-2,3,4-trifluoro-4-(4-nitrophenyl)butyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 139041379 |
| Molecular Formula | C36H26F6N4O8 |
| Molecular Weight | 756.61 g/mol |
| Exact Mass | 756.17 |
| IUPAC Name | 2-[(2S,3S,4S)-2,3,4-trifluoro-4-(4-nitrophenyl)butyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1C[C@H](F)[C@@H](F)[C@@H](F)c1ccc([N+](=O)[O-])cc1.O=C1c2ccccc2C(=O)N1C[C@H](F)[C@@H](F)[C@@H](F)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/2C18H13F3N2O4/c2*19-14(9-22-17(24)12-3-1-2-4-13(12)18(22)25)16(21)15(20)10-5-7-11(8-6-10)23(26)27/h2*1-8,14-16H,9H2/t2*14-,15-,16+/m00/s1 |
| InChIKey | SIGNPZBVLNNJBB-QFWFWQNCSA-N |
| XLogP | 7.16 |
| TPSA | 161.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.61 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|