C16H11N3O5S — CID 5278728
O-[(1,3-dioxoisoindol-2-yl)methyl] N-(4-nitrophenyl)carbamothioate (PubChem CID 5278728) has the molecular formula C16H11N3O5S and a molecular weight of 357.35 g/mol. Its IUPAC name is O-[(1,3-dioxoisoindol-2-yl)methyl] N-(4-nitrophenyl)carbamothioate.
| Compound Name | O-[(1,3-dioxoisoindol-2-yl)methyl] N-(4-nitrophenyl)carbamothioate |
|---|---|
| PubChem CID | 5278728 |
| Molecular Formula | C16H11N3O5S |
| Molecular Weight | 357.35 g/mol |
| Exact Mass | 357.04 |
| IUPAC Name | O-[(1,3-dioxoisoindol-2-yl)methyl] N-(4-nitrophenyl)carbamothioate |
| SMILES | O=C1c2ccccc2C(=O)N1COC(=S)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H11N3O5S/c20-14-12-3-1-2-4-13(12)15(21)18(14)9-24-16(25)17-10-5-7-11(8-6-10)19(22)23/h1-8H,9H2,(H,17,25) |
| InChIKey | RAMSGUDTNPUBBI-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.35 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|