About O-(2-pyridin-4-ylethyl) N-(4-nitrophenyl)carbamothioate
O-(2-pyridin-4-ylethyl) N-(4-nitrophenyl)carbamothioate (PubChem CID 44560177) has the molecular formula C14H13N3O3S
and a molecular weight of 303.34 g/mol. Its IUPAC name is O-(2-pyridin-4-ylethyl) N-(4-nitrophenyl)carbamothioate.
Molecular Properties
| Compound Name | O-(2-pyridin-4-ylethyl) N-(4-nitrophenyl)carbamothioate |
| PubChem CID | 44560177 |
| Molecular Formula | C14H13N3O3S |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | O-(2-pyridin-4-ylethyl) N-(4-nitrophenyl)carbamothioate |
| SMILES | O=[N+]([O-])c1ccc(NC(=S)OCCc2ccncc2)cc1 |
| InChI | InChI=1S/C14H13N3O3S/c18-17(19)13-3-1-12(2-4-13)16-14(21)20-10-7-11-5-8-15-9-6-11/h1-6,8-9H,7,10H2,(H,16,21) |
| InChIKey | UOVCJSNHBFVXCB-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 77.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-(2-pyridin-4-ylethyl) N-(4-nitrophenyl)carbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-(2-pyridin-4-ylethyl) N-(4-nitrophenyl)carbamothioate?
The IUPAC name of O-(2-pyridin-4-ylethyl) N-(4-nitrophenyl)carbamothioate (CID 44560177) is O-(2-pyridin-4-ylethyl) N-(4-nitrophenyl)carbamothioate.
What is the SMILES notation for O-(2-pyridin-4-ylethyl) N-(4-nitrophenyl)carbamothioate?
The canonical SMILES for O-(2-pyridin-4-ylethyl) N-(4-nitrophenyl)carbamothioate is O=[N+]([O-])c1ccc(NC(=S)OCCc2ccncc2)cc1.
What is the InChIKey of O-(2-pyridin-4-ylethyl) N-(4-nitrophenyl)carbamothioate?
The InChIKey is UOVCJSNHBFVXCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N3O3S/c18-17(19)13-3-1-12(2-4-13)16-14(21)20-10-7-11-5-8-15-9-6-11/h1-6,8-9H,7,10H2,(H,16,21).
What are the key properties of O-(2-pyridin-4-ylethyl) N-(4-nitrophenyl)carbamothioate?
O-(2-pyridin-4-ylethyl) N-(4-nitrophenyl)carbamothioate has a molecular weight of 303.34 g/mol, XLogP of 2.95, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for O-(2-pyridin-4-ylethyl) N-(4-nitrophenyl)carbamothioate is sourced from PubChem (CID 44560177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).