About bis(O-ethyl N-(4-nitrophenyl)carbamothioate);4-pyridin-4-ylpyridine
bis(O-ethyl N-(4-nitrophenyl)carbamothioate);4-pyridin-4-ylpyridine (PubChem CID 139194362) has the molecular formula C28H28N6O6S2
and a molecular weight of 608.70 g/mol. Its IUPAC name is bis(O-ethyl N-(4-nitrophenyl)carbamothioate);4-pyridin-4-ylpyridine.
Molecular Properties
| Compound Name | bis(O-ethyl N-(4-nitrophenyl)carbamothioate);4-pyridin-4-ylpyridine |
| PubChem CID | 139194362 |
| Molecular Formula | C28H28N6O6S2 |
| Molecular Weight | 608.70 g/mol |
| Exact Mass | 608.15 |
| IUPAC Name | bis(O-ethyl N-(4-nitrophenyl)carbamothioate);4-pyridin-4-ylpyridine |
| SMILES | CCOC(=S)Nc1ccc([N+](=O)[O-])cc1.CCOC(=S)Nc1ccc([N+](=O)[O-])cc1.c1cc(-c2ccncc2)ccn1 |
| InChI | InChI=1S/C10H8N2.2C9H10N2O3S/c1-5-11-6-2-9(1)10-3-7-12-8-4-10;2*1-2-14-9(15)10-7-3-5-8(6-4-7)11(12)13/h1-8H;2*3-6H,2H2,1H3,(H,10,15) |
| InChIKey | ZDWFUNYKTWKBOQ-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 154.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 608.70 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze bis(O-ethyl N-(4-nitrophenyl)carbamothioate);4-pyridin-4-ylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(O-ethyl N-(4-nitrophenyl)carbamothioate);4-pyridin-4-ylpyridine?
The IUPAC name of bis(O-ethyl N-(4-nitrophenyl)carbamothioate);4-pyridin-4-ylpyridine (CID 139194362) is bis(O-ethyl N-(4-nitrophenyl)carbamothioate);4-pyridin-4-ylpyridine.
What is the SMILES notation for bis(O-ethyl N-(4-nitrophenyl)carbamothioate);4-pyridin-4-ylpyridine?
The canonical SMILES for bis(O-ethyl N-(4-nitrophenyl)carbamothioate);4-pyridin-4-ylpyridine is CCOC(=S)Nc1ccc([N+](=O)[O-])cc1.CCOC(=S)Nc1ccc([N+](=O)[O-])cc1.c1cc(-c2ccncc2)ccn1.
What is the InChIKey of bis(O-ethyl N-(4-nitrophenyl)carbamothioate);4-pyridin-4-ylpyridine?
The InChIKey is ZDWFUNYKTWKBOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2.2C9H10N2O3S/c1-5-11-6-2-9(1)10-3-7-12-8-4-10;2*1-2-14-9(15)10-7-3-5-8(6-4-7)11(12)13/h1-8H;2*3-6H,2H2,1H3,(H,10,15).
What are the key properties of bis(O-ethyl N-(4-nitrophenyl)carbamothioate);4-pyridin-4-ylpyridine?
bis(O-ethyl N-(4-nitrophenyl)carbamothioate);4-pyridin-4-ylpyridine has a molecular weight of 608.70 g/mol, XLogP of 6.80, 7 rotatable bonds, 2 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for bis(O-ethyl N-(4-nitrophenyl)carbamothioate);4-pyridin-4-ylpyridine is sourced from PubChem (CID 139194362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).