C12H6F3N3O4S — CID 174787933
3-(5-nitro-1,3-dioxoisoindol-2-yl)-2-(trifluoromethylsulfanyl)propanenitrile (PubChem CID 174787933) has the molecular formula C12H6F3N3O4S and a molecular weight of 345.26 g/mol. Its IUPAC name is 3-(5-nitro-1,3-dioxoisoindol-2-yl)-2-(trifluoromethylsulfanyl)propanenitrile.
| Compound Name | 3-(5-nitro-1,3-dioxoisoindol-2-yl)-2-(trifluoromethylsulfanyl)propanenitrile |
|---|---|
| PubChem CID | 174787933 |
| Molecular Formula | C12H6F3N3O4S |
| Molecular Weight | 345.26 g/mol |
| Exact Mass | 345.00 |
| IUPAC Name | 3-(5-nitro-1,3-dioxoisoindol-2-yl)-2-(trifluoromethylsulfanyl)propanenitrile |
| SMILES | N#CC(CN1C(=O)c2ccc([N+](=O)[O-])cc2C1=O)SC(F)(F)F |
| InChI | InChI=1S/C12H6F3N3O4S/c13-12(14,15)23-7(4-16)5-17-10(19)8-2-1-6(18(21)22)3-9(8)11(17)20/h1-3,7H,5H2 |
| InChIKey | MDUUBWBQTBAKIN-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 104.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.26 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|