C18H22N2O3S — CID 72919090
2-[4-[(2-methoxyphenyl)methyl]piperazin-1-yl]-2-thiophen-3-ylacetic acid (PubChem CID 72919090) has the molecular formula C18H22N2O3S and a molecular weight of 346.45 g/mol. Its IUPAC name is 2-[4-[(2-methoxyphenyl)methyl]piperazin-1-yl]-2-thiophen-3-ylacetic acid.
| Compound Name | 2-[4-[(2-methoxyphenyl)methyl]piperazin-1-yl]-2-thiophen-3-ylacetic acid |
|---|---|
| PubChem CID | 72919090 |
| Molecular Formula | C18H22N2O3S |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 2-[4-[(2-methoxyphenyl)methyl]piperazin-1-yl]-2-thiophen-3-ylacetic acid |
| SMILES | COc1ccccc1CN1CCN(C(C(=O)O)c2ccsc2)CC1 |
| InChI | InChI=1S/C18H22N2O3S/c1-23-16-5-3-2-4-14(16)12-19-7-9-20(10-8-19)17(18(21)22)15-6-11-24-13-15/h2-6,11,13,17H,7-10,12H2,1H3,(H,21,22) |
| InChIKey | BORKNGVGZCVPBI-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |