C16H24N2O5 — CID 83979929
2-(2-methylpiperazin-1-yl)-2-(2,4,5-trimethoxyphenyl)acetic acid (PubChem CID 83979929) has the molecular formula C16H24N2O5 and a molecular weight of 324.38 g/mol. Its IUPAC name is 2-(2-methylpiperazin-1-yl)-2-(2,4,5-trimethoxyphenyl)acetic acid.
| Compound Name | 2-(2-methylpiperazin-1-yl)-2-(2,4,5-trimethoxyphenyl)acetic acid |
|---|---|
| PubChem CID | 83979929 |
| Molecular Formula | C16H24N2O5 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | 2-(2-methylpiperazin-1-yl)-2-(2,4,5-trimethoxyphenyl)acetic acid |
| SMILES | COc1cc(OC)c(C(C(=O)O)N2CCNCC2C)cc1OC |
| InChI | InChI=1S/C16H24N2O5/c1-10-9-17-5-6-18(10)15(16(19)20)11-7-13(22-3)14(23-4)8-12(11)21-2/h7-8,10,15,17H,5-6,9H2,1-4H3,(H,19,20) |
| InChIKey | UVCQVNVXPLSVKX-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 80.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |