C19H27FN2O4 — CID 72940551
2-(4-fluoro-2-methoxyphenyl)-2-[4-(morpholin-4-ylmethyl)piperidin-1-yl]acetic acid (PubChem CID 72940551) has the molecular formula C19H27FN2O4 and a molecular weight of 366.43 g/mol. Its IUPAC name is 2-(4-fluoro-2-methoxyphenyl)-2-[4-(morpholin-4-ylmethyl)piperidin-1-yl]acetic acid.
| Compound Name | 2-(4-fluoro-2-methoxyphenyl)-2-[4-(morpholin-4-ylmethyl)piperidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 72940551 |
| Molecular Formula | C19H27FN2O4 |
| Molecular Weight | 366.43 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | 2-(4-fluoro-2-methoxyphenyl)-2-[4-(morpholin-4-ylmethyl)piperidin-1-yl]acetic acid |
| SMILES | COc1cc(F)ccc1C(C(=O)O)N1CCC(CN2CCOCC2)CC1 |
| InChI | InChI=1S/C19H27FN2O4/c1-25-17-12-15(20)2-3-16(17)18(19(23)24)22-6-4-14(5-7-22)13-21-8-10-26-11-9-21/h2-3,12,14,18H,4-11,13H2,1H3,(H,23,24) |
| InChIKey | KVHQJLHLQYIRGR-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.43 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |