C20H31N3O3 — CID 166622015
2-[4-[4-(2-hydroxyethyl)piperazin-1-yl]piperidin-1-yl]-2-(3-methylphenyl)acetic acid (PubChem CID 166622015) has the molecular formula C20H31N3O3 and a molecular weight of 361.49 g/mol. Its IUPAC name is 2-[4-[4-(2-hydroxyethyl)piperazin-1-yl]piperidin-1-yl]-2-(3-methylphenyl)acetic acid.
| Compound Name | 2-[4-[4-(2-hydroxyethyl)piperazin-1-yl]piperidin-1-yl]-2-(3-methylphenyl)acetic acid |
|---|---|
| PubChem CID | 166622015 |
| Molecular Formula | C20H31N3O3 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.24 |
| IUPAC Name | 2-[4-[4-(2-hydroxyethyl)piperazin-1-yl]piperidin-1-yl]-2-(3-methylphenyl)acetic acid |
| SMILES | Cc1cccc(C(C(=O)O)N2CCC(N3CCN(CCO)CC3)CC2)c1 |
| InChI | InChI=1S/C20H31N3O3/c1-16-3-2-4-17(15-16)19(20(25)26)23-7-5-18(6-8-23)22-11-9-21(10-12-22)13-14-24/h2-4,15,18-19,24H,5-14H2,1H3,(H,25,26) |
| InChIKey | MTGNJSGAJKYXKK-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 67.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |