C18H24FNO3 — CID 155953672
2-(4-cyclobutyloxyazepan-1-yl)-2-(4-fluorophenyl)acetic acid (PubChem CID 155953672) has the molecular formula C18H24FNO3 and a molecular weight of 321.39 g/mol. Its IUPAC name is 2-(4-cyclobutyloxyazepan-1-yl)-2-(4-fluorophenyl)acetic acid.
| Compound Name | 2-(4-cyclobutyloxyazepan-1-yl)-2-(4-fluorophenyl)acetic acid |
|---|---|
| PubChem CID | 155953672 |
| Molecular Formula | C18H24FNO3 |
| Molecular Weight | 321.39 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | 2-(4-cyclobutyloxyazepan-1-yl)-2-(4-fluorophenyl)acetic acid |
| SMILES | O=C(O)C(c1ccc(F)cc1)N1CCCC(OC2CCC2)CC1 |
| InChI | InChI=1S/C18H24FNO3/c19-14-8-6-13(7-9-14)17(18(21)22)20-11-2-5-16(10-12-20)23-15-3-1-4-15/h6-9,15-17H,1-5,10-12H2,(H,21,22) |
| InChIKey | CNTCIFUMJWYMTE-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.39 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |