C16H20FNO3 — CID 155956084
2-(6-cyclopropyl-1,4-oxazepan-4-yl)-2-(4-fluorophenyl)acetic acid (PubChem CID 155956084) has the molecular formula C16H20FNO3 and a molecular weight of 293.34 g/mol. Its IUPAC name is 2-(6-cyclopropyl-1,4-oxazepan-4-yl)-2-(4-fluorophenyl)acetic acid.
| Compound Name | 2-(6-cyclopropyl-1,4-oxazepan-4-yl)-2-(4-fluorophenyl)acetic acid |
|---|---|
| PubChem CID | 155956084 |
| Molecular Formula | C16H20FNO3 |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 2-(6-cyclopropyl-1,4-oxazepan-4-yl)-2-(4-fluorophenyl)acetic acid |
| SMILES | O=C(O)C(c1ccc(F)cc1)N1CCOCC(C2CC2)C1 |
| InChI | InChI=1S/C16H20FNO3/c17-14-5-3-12(4-6-14)15(16(19)20)18-7-8-21-10-13(9-18)11-1-2-11/h3-6,11,13,15H,1-2,7-10H2,(H,19,20) |
| InChIKey | VGPHVBWQEUQUTF-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |