C11H19N3O2S2 — CID 60857110
5-(aminomethyl)-N-[(1-methylpyrrolidin-3-yl)methyl]thiophene-2-sulfonamide (PubChem CID 60857110) has the molecular formula C11H19N3O2S2 and a molecular weight of 289.43 g/mol. Its IUPAC name is 5-(aminomethyl)-N-[(1-methylpyrrolidin-3-yl)methyl]thiophene-2-sulfonamide.
| Compound Name | 5-(aminomethyl)-N-[(1-methylpyrrolidin-3-yl)methyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 60857110 |
| Molecular Formula | C11H19N3O2S2 |
| Molecular Weight | 289.43 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 5-(aminomethyl)-N-[(1-methylpyrrolidin-3-yl)methyl]thiophene-2-sulfonamide |
| SMILES | CN1CCC(CNS(=O)(=O)c2ccc(CN)s2)C1 |
| InChI | InChI=1S/C11H19N3O2S2/c1-14-5-4-9(8-14)7-13-18(15,16)11-3-2-10(6-12)17-11/h2-3,9,13H,4-8,12H2,1H3 |
| InChIKey | ATINSYHIOQPEIF-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.43 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |