C12H21N3O2S2 — CID 43332877
5-(aminomethyl)-N-methyl-N-(1-methylpiperidin-4-yl)thiophene-2-sulfonamide (PubChem CID 43332877) has the molecular formula C12H21N3O2S2 and a molecular weight of 303.45 g/mol. Its IUPAC name is 5-(aminomethyl)-N-methyl-N-(1-methylpiperidin-4-yl)thiophene-2-sulfonamide.
| Compound Name | 5-(aminomethyl)-N-methyl-N-(1-methylpiperidin-4-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 43332877 |
| Molecular Formula | C12H21N3O2S2 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 5-(aminomethyl)-N-methyl-N-(1-methylpiperidin-4-yl)thiophene-2-sulfonamide |
| SMILES | CN1CCC(N(C)S(=O)(=O)c2ccc(CN)s2)CC1 |
| InChI | InChI=1S/C12H21N3O2S2/c1-14-7-5-10(6-8-14)15(2)19(16,17)12-4-3-11(9-13)18-12/h3-4,10H,5-9,13H2,1-2H3 |
| InChIKey | DWMOPCPLFVCYCQ-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |