About 5-(aminomethyl)-N-(2,3-dihydro-1H-inden-1-yl)-N-methylthiophene-2-sulfonamide
5-(aminomethyl)-N-(2,3-dihydro-1H-inden-1-yl)-N-methylthiophene-2-sulfonamide (PubChem CID 106266202) has the molecular formula C15H18N2O2S2
and a molecular weight of 322.46 g/mol. Its IUPAC name is 5-(aminomethyl)-N-(2,3-dihydro-1H-inden-1-yl)-N-methylthiophene-2-sulfonamide.
Molecular Properties
| Compound Name | 5-(aminomethyl)-N-(2,3-dihydro-1H-inden-1-yl)-N-methylthiophene-2-sulfonamide |
| PubChem CID | 106266202 |
| Molecular Formula | C15H18N2O2S2 |
| Molecular Weight | 322.46 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | 5-(aminomethyl)-N-(2,3-dihydro-1H-inden-1-yl)-N-methylthiophene-2-sulfonamide |
| SMILES | CN(C1CCc2ccccc21)S(=O)(=O)c1ccc(CN)s1 |
| InChI | InChI=1S/C15H18N2O2S2/c1-17(14-8-6-11-4-2-3-5-13(11)14)21(18,19)15-9-7-12(10-16)20-15/h2-5,7,9,14H,6,8,10,16H2,1H3 |
| InChIKey | TYQVLWMPELCJDZ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.46 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(aminomethyl)-N-(2,3-dihydro-1H-inden-1-yl)-N-methylthiophene-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(aminomethyl)-N-(2,3-dihydro-1H-inden-1-yl)-N-methylthiophene-2-sulfonamide?
The IUPAC name of 5-(aminomethyl)-N-(2,3-dihydro-1H-inden-1-yl)-N-methylthiophene-2-sulfonamide (CID 106266202) is 5-(aminomethyl)-N-(2,3-dihydro-1H-inden-1-yl)-N-methylthiophene-2-sulfonamide.
What is the SMILES notation for 5-(aminomethyl)-N-(2,3-dihydro-1H-inden-1-yl)-N-methylthiophene-2-sulfonamide?
The canonical SMILES for 5-(aminomethyl)-N-(2,3-dihydro-1H-inden-1-yl)-N-methylthiophene-2-sulfonamide is CN(C1CCc2ccccc21)S(=O)(=O)c1ccc(CN)s1.
What is the InChIKey of 5-(aminomethyl)-N-(2,3-dihydro-1H-inden-1-yl)-N-methylthiophene-2-sulfonamide?
The InChIKey is TYQVLWMPELCJDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2O2S2/c1-17(14-8-6-11-4-2-3-5-13(11)14)21(18,19)15-9-7-12(10-16)20-15/h2-5,7,9,14H,6,8,10,16H2,1H3.
What are the key properties of 5-(aminomethyl)-N-(2,3-dihydro-1H-inden-1-yl)-N-methylthiophene-2-sulfonamide?
5-(aminomethyl)-N-(2,3-dihydro-1H-inden-1-yl)-N-methylthiophene-2-sulfonamide has a molecular weight of 322.46 g/mol, XLogP of 2.51, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(aminomethyl)-N-(2,3-dihydro-1H-inden-1-yl)-N-methylthiophene-2-sulfonamide is sourced from PubChem (CID 106266202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).