C13H15N3O2S — CID 102691703
N-(2,3-dihydro-1H-inden-1-yl)-N-methyl-1H-pyrazole-5-sulfonamide (PubChem CID 102691703) has the molecular formula C13H15N3O2S and a molecular weight of 277.35 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-inden-1-yl)-N-methyl-1H-pyrazole-5-sulfonamide.
| Compound Name | N-(2,3-dihydro-1H-inden-1-yl)-N-methyl-1H-pyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 102691703 |
| Molecular Formula | C13H15N3O2S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | N-(2,3-dihydro-1H-inden-1-yl)-N-methyl-1H-pyrazole-5-sulfonamide |
| SMILES | CN(C1CCc2ccccc21)S(=O)(=O)c1ccn[nH]1 |
| InChI | InChI=1S/C13H15N3O2S/c1-16(19(17,18)13-8-9-14-15-13)12-7-6-10-4-2-3-5-11(10)12/h2-5,8-9,12H,6-7H2,1H3,(H,14,15) |
| InChIKey | NNWQFQJQOPUWSW-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |