C13H16LiN — CID 10511981
lithium (1R)-N-methyl-N-prop-2-enyl-2,3-dihydro-1H-inden-1-amine (PubChem CID 10511981) has the molecular formula C13H16LiN and a molecular weight of 193.22 g/mol. Its IUPAC name is lithium (1R)-N-methyl-N-prop-2-enyl-2,3-dihydro-1H-inden-1-amine.
| Compound Name | lithium (1R)-N-methyl-N-prop-2-enyl-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 10511981 |
| Molecular Formula | C13H16LiN |
| Molecular Weight | 193.22 g/mol |
| Exact Mass | 193.14 |
| IUPAC Name | lithium (1R)-N-methyl-N-prop-2-enyl-2,3-dihydro-1H-inden-1-amine |
| SMILES | C=[C-]CN(C)[C@@H]1CCc2ccccc21.[Li+] |
| InChI | InChI=1S/C13H16N.Li/c1-3-10-14(2)13-9-8-11-6-4-5-7-12(11)13;/h4-7,13H,1,8-10H2,2H3;/q-1;+1/t13-;/m1./s1 |
| InChIKey | GTNHDAHDTYWCBP-BTQNPOSSSA-N |
| XLogP | -0.40 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.22 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|