C12H14BrN — CID 87326008
(1R)-N-bromo-N-prop-2-enyl-2,3-dihydro-1H-inden-1-amine (PubChem CID 87326008) has the molecular formula C12H14BrN and a molecular weight of 252.15 g/mol. Its IUPAC name is (1R)-N-bromo-N-prop-2-enyl-2,3-dihydro-1H-inden-1-amine.
| Compound Name | (1R)-N-bromo-N-prop-2-enyl-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 87326008 |
| Molecular Formula | C12H14BrN |
| Molecular Weight | 252.15 g/mol |
| Exact Mass | 251.03 |
| IUPAC Name | (1R)-N-bromo-N-prop-2-enyl-2,3-dihydro-1H-inden-1-amine |
| SMILES | C=CCN(Br)[C@@H]1CCc2ccccc21 |
| InChI | InChI=1S/C12H14BrN/c1-2-9-14(13)12-8-7-10-5-3-4-6-11(10)12/h2-6,12H,1,7-9H2/t12-/m1/s1 |
| InChIKey | LTMAPFPZAHRNQO-GFCCVEGCSA-N |
| XLogP | 3.47 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.15 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|