About 5-cyano-N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]thiophene-2-sulfonamide
5-cyano-N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]thiophene-2-sulfonamide (PubChem CID 106272528) has the molecular formula C14H12N2O3S2
and a molecular weight of 320.40 g/mol. Its IUPAC name is 5-cyano-N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]thiophene-2-sulfonamide.
Molecular Properties
| Compound Name | 5-cyano-N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]thiophene-2-sulfonamide |
| PubChem CID | 106272528 |
| Molecular Formula | C14H12N2O3S2 |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.03 |
| IUPAC Name | 5-cyano-N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]thiophene-2-sulfonamide |
| SMILES | N#Cc1ccc(S(=O)(=O)N[C@H]2c3ccccc3C[C@H]2O)s1 |
| InChI | InChI=1S/C14H12N2O3S2/c15-8-10-5-6-13(20-10)21(18,19)16-14-11-4-2-1-3-9(11)7-12(14)17/h1-6,12,14,16-17H,7H2/t12-,14+/m1/s1 |
| InChIKey | MPTOHEWUZSUVLN-OCCSQVGLSA-N |
| XLogP | 1.56 |
| TPSA | 90.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-cyano-N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]thiophene-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyano-N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]thiophene-2-sulfonamide?
The IUPAC name of 5-cyano-N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]thiophene-2-sulfonamide (CID 106272528) is 5-cyano-N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]thiophene-2-sulfonamide.
What is the SMILES notation for 5-cyano-N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]thiophene-2-sulfonamide?
The canonical SMILES for 5-cyano-N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]thiophene-2-sulfonamide is N#Cc1ccc(S(=O)(=O)N[C@H]2c3ccccc3C[C@H]2O)s1.
What is the InChIKey of 5-cyano-N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]thiophene-2-sulfonamide?
The InChIKey is MPTOHEWUZSUVLN-OCCSQVGLSA-N. The full InChI is InChI=1S/C14H12N2O3S2/c15-8-10-5-6-13(20-10)21(18,19)16-14-11-4-2-1-3-9(11)7-12(14)17/h1-6,12,14,16-17H,7H2/t12-,14+/m1/s1.
What are the key properties of 5-cyano-N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]thiophene-2-sulfonamide?
5-cyano-N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]thiophene-2-sulfonamide has a molecular weight of 320.40 g/mol, XLogP of 1.56, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyano-N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]thiophene-2-sulfonamide is sourced from PubChem (CID 106272528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).